About chloro(diphenyl)stannanylium;2-[(4-oxochromen-3-yl)methylideneamino]ethanolate
chloro(diphenyl)stannanylium;2-[(4-oxochromen-3-yl)methylideneamino]ethanolate (PubChem CID 72701504) has the molecular formula C24H20ClNO3Sn
and a molecular weight of 524.59 g/mol. Its IUPAC name is chloro(diphenyl)stannanylium;2-[(4-oxochromen-3-yl)methylideneamino]ethanolate.
Molecular Properties
| Compound Name | chloro(diphenyl)stannanylium;2-[(4-oxochromen-3-yl)methylideneamino]ethanolate |
| PubChem CID | 72701504 |
| Molecular Formula | C24H20ClNO3Sn |
| Molecular Weight | 524.59 g/mol |
| Exact Mass | 525.02 |
| IUPAC Name | chloro(diphenyl)stannanylium;2-[(4-oxochromen-3-yl)methylideneamino]ethanolate |
| SMILES | Cl[Sn+](c1ccccc1)c1ccccc1.O=c1c(/C=N/CC[O-])coc2ccccc12 |
| InChI | InChI=1S/C12H10NO3.2C6H5.ClH.Sn/c14-6-5-13-7-9-8-16-11-4-2-1-3-10(11)12(9)15;2*1-2-4-6-5-3-1;;/h1-4,7-8H,5-6H2;2*1-5H;1H;/q-1;;;;+2/p-1/b13-7+;;;; |
| InChIKey | YVTFZPCPTDFTIG-BHZDOTFFSA-M |
| XLogP | 2.60 |
| TPSA | 65.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 524.59 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze chloro(diphenyl)stannanylium;2-[(4-oxochromen-3-yl)methylideneamino]ethanolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro(diphenyl)stannanylium;2-[(4-oxochromen-3-yl)methylideneamino]ethanolate?
The IUPAC name of chloro(diphenyl)stannanylium;2-[(4-oxochromen-3-yl)methylideneamino]ethanolate (CID 72701504) is chloro(diphenyl)stannanylium;2-[(4-oxochromen-3-yl)methylideneamino]ethanolate.
What is the SMILES notation for chloro(diphenyl)stannanylium;2-[(4-oxochromen-3-yl)methylideneamino]ethanolate?
The canonical SMILES for chloro(diphenyl)stannanylium;2-[(4-oxochromen-3-yl)methylideneamino]ethanolate is Cl[Sn+](c1ccccc1)c1ccccc1.O=c1c(/C=N/CC[O-])coc2ccccc12.
What is the InChIKey of chloro(diphenyl)stannanylium;2-[(4-oxochromen-3-yl)methylideneamino]ethanolate?
The InChIKey is YVTFZPCPTDFTIG-BHZDOTFFSA-M. The full InChI is InChI=1S/C12H10NO3.2C6H5.ClH.Sn/c14-6-5-13-7-9-8-16-11-4-2-1-3-10(11)12(9)15;2*1-2-4-6-5-3-1;;/h1-4,7-8H,5-6H2;2*1-5H;1H;/q-1;;;;+2/p-1/b13-7+;;;;.
What are the key properties of chloro(diphenyl)stannanylium;2-[(4-oxochromen-3-yl)methylideneamino]ethanolate?
chloro(diphenyl)stannanylium;2-[(4-oxochromen-3-yl)methylideneamino]ethanolate has a molecular weight of 524.59 g/mol, XLogP of 2.60, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for chloro(diphenyl)stannanylium;2-[(4-oxochromen-3-yl)methylideneamino]ethanolate is sourced from PubChem (CID 72701504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).