C33H61BrN2+2 — CID 145263417
bromomethane;4-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]pyridin-1-ium-1-yl]butyl-dimethylazanium;tetradecane (PubChem CID 145263417) has the molecular formula C33H61BrN2+2 and a molecular weight of 565.77 g/mol. Its IUPAC name is bromomethane;4-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]pyridin-1-ium-1-yl]butyl-dimethylazanium;tetradecane.
| Compound Name | bromomethane;4-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]pyridin-1-ium-1-yl]butyl-dimethylazanium;tetradecane |
|---|---|
| PubChem CID | 145263417 |
| Molecular Formula | C33H61BrN2+2 |
| Molecular Weight | 565.77 g/mol |
| Exact Mass | 564.40 |
| IUPAC Name | bromomethane;4-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]pyridin-1-ium-1-yl]butyl-dimethylazanium;tetradecane |
| SMILES | C=C/C=C(\C=C/C)c1cc[n+](CCCC[NH+](C)C)cc1.CBr.CCCCCCCCCCCCCC |
| InChI | InChI=1S/C18H27N2.C14H30.CH3Br/c1-5-9-17(10-6-2)18-11-15-20(16-12-18)14-8-7-13-19(3)4;1-3-5-7-9-11-13-14-12-10-8-6-4-2;1-2/h5-6,9-12,15-16H,1,7-8,13-14H2,2-4H3;3-14H2,1-2H3;1H3/q+1;;/p+1/b10-6-,17-9+;; |
| InChIKey | KYXHHEMHCLNQFT-QRXGESRXSA-O |
| XLogP | 8.76 |
| TPSA | 8.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.77 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|