C28H32 — CID 142935495
1-[(2Z,4E,6E,9Z)-7-ethenyl-5-methyl-8-methylideneundeca-2,4,6,9-tetraen-6-yl]-4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]benzene (PubChem CID 142935495) has the molecular formula C28H32 and a molecular weight of 368.56 g/mol. Its IUPAC name is 1-[(2Z,4E,6E,9Z)-7-ethenyl-5-methyl-8-methylideneundeca-2,4,6,9-tetraen-6-yl]-4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]benzene.
| Compound Name | 1-[(2Z,4E,6E,9Z)-7-ethenyl-5-methyl-8-methylideneundeca-2,4,6,9-tetraen-6-yl]-4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]benzene |
|---|---|
| PubChem CID | 142935495 |
| Molecular Formula | C28H32 |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.25 |
| IUPAC Name | 1-[(2Z,4E,6E,9Z)-7-ethenyl-5-methyl-8-methylideneundeca-2,4,6,9-tetraen-6-yl]-4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]benzene |
| SMILES | C=C/C=C(\C=C/C)c1ccc(C(/C(C)=C/C=C\C)=C(\C=C)C(=C)/C=C\C)cc1 |
| InChI | InChI=1S/C28H32/c1-8-13-17-23(7)28(27(12-5)22(6)14-9-2)26-20-18-25(19-21-26)24(15-10-3)16-11-4/h8-21H,3,5-6H2,1-2,4,7H3/b13-8-,14-9-,16-11-,23-17+,24-15+,28-27+ |
| InChIKey | IRXCQNKGENLLFR-KWXZGAGQSA-N |
| XLogP | 8.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|