C20H25FO2 — CID 144561317
[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]phenyl] 2-fluoro-2,3,3-trimethylbutanoate (PubChem CID 144561317) has the molecular formula C20H25FO2 and a molecular weight of 316.42 g/mol. Its IUPAC name is [4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]phenyl] 2-fluoro-2,3,3-trimethylbutanoate.
| Compound Name | [4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]phenyl] 2-fluoro-2,3,3-trimethylbutanoate |
|---|---|
| PubChem CID | 144561317 |
| Molecular Formula | C20H25FO2 |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | [4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]phenyl] 2-fluoro-2,3,3-trimethylbutanoate |
| SMILES | C=C/C=C(\C=C/C)c1ccc(OC(=O)C(C)(F)C(C)(C)C)cc1 |
| InChI | InChI=1S/C20H25FO2/c1-7-9-15(10-8-2)16-11-13-17(14-12-16)23-18(22)20(6,21)19(3,4)5/h7-14H,1H2,2-6H3/b10-8-,15-9+ |
| InChIKey | BTAPWPMPKNJIEJ-MNSIHRJDSA-N |
| XLogP | 5.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|