C21H15NO3 — CID 91524208
[4-(1-cyanohepta-1,2,4,6-tetraen-4-yl)phenyl] 4-hydroxybenzoate (PubChem CID 91524208) has the molecular formula C21H15NO3 and a molecular weight of 329.36 g/mol. Its IUPAC name is [4-(1-cyanohepta-1,2,4,6-tetraen-4-yl)phenyl] 4-hydroxybenzoate.
| Compound Name | [4-(1-cyanohepta-1,2,4,6-tetraen-4-yl)phenyl] 4-hydroxybenzoate |
|---|---|
| PubChem CID | 91524208 |
| Molecular Formula | C21H15NO3 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | [4-(1-cyanohepta-1,2,4,6-tetraen-4-yl)phenyl] 4-hydroxybenzoate |
| SMILES | C=CC=C(C=C=CC#N)c1ccc(OC(=O)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C21H15NO3/c1-2-5-16(6-3-4-15-22)17-9-13-20(14-10-17)25-21(24)18-7-11-19(23)12-8-18/h2,4-14,23H,1H2 |
| InChIKey | WJLYSARXACNVEA-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|