C28H27NO5 — CID 162268230
[4-(7-cyanohepta-1,3,5-trien-4-yl)phenyl] 4-hydroxybenzoate;ethynyl 2-methylbutanoate (PubChem CID 162268230) has the molecular formula C28H27NO5 and a molecular weight of 457.53 g/mol. Its IUPAC name is [4-(7-cyanohepta-1,3,5-trien-4-yl)phenyl] 4-hydroxybenzoate;ethynyl 2-methylbutanoate.
| Compound Name | [4-(7-cyanohepta-1,3,5-trien-4-yl)phenyl] 4-hydroxybenzoate;ethynyl 2-methylbutanoate |
|---|---|
| PubChem CID | 162268230 |
| Molecular Formula | C28H27NO5 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | [4-(7-cyanohepta-1,3,5-trien-4-yl)phenyl] 4-hydroxybenzoate;ethynyl 2-methylbutanoate |
| SMILES | C#COC(=O)C(C)CC.C=CC=C(C=CCC#N)c1ccc(OC(=O)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C21H17NO3.C7H10O2/c1-2-5-16(6-3-4-15-22)17-9-13-20(14-10-17)25-21(24)18-7-11-19(23)12-8-18;1-4-6(3)7(8)9-5-2/h2-3,5-14,23H,1,4H2;2,6H,4H2,1,3H3 |
| InChIKey | PBMOTNLXVTWIBM-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 96.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|