About [4-(4-cyanatobenzoyl)oxyphenyl] 4-cyanatobenzoate
[4-(4-cyanatobenzoyl)oxyphenyl] 4-cyanatobenzoate (PubChem CID 23373872) has the molecular formula C22H12N2O6
and a molecular weight of 400.35 g/mol. Its IUPAC name is [4-(4-cyanatobenzoyl)oxyphenyl] 4-cyanatobenzoate.
Molecular Properties
| Compound Name | [4-(4-cyanatobenzoyl)oxyphenyl] 4-cyanatobenzoate |
| PubChem CID | 23373872 |
| Molecular Formula | C22H12N2O6 |
| Molecular Weight | 400.35 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | [4-(4-cyanatobenzoyl)oxyphenyl] 4-cyanatobenzoate |
| SMILES | N#COc1ccc(C(=O)Oc2ccc(OC(=O)c3ccc(OC#N)cc3)cc2)cc1 |
| InChI | InChI=1S/C22H12N2O6/c23-13-27-17-5-1-15(2-6-17)21(25)29-19-9-11-20(12-10-19)30-22(26)16-3-7-18(8-4-16)28-14-24/h1-12H |
| InChIKey | DKLODNBJFDRAIV-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 118.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.35 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(4-cyanatobenzoyl)oxyphenyl] 4-cyanatobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-cyanatobenzoyl)oxyphenyl] 4-cyanatobenzoate?
The IUPAC name of [4-(4-cyanatobenzoyl)oxyphenyl] 4-cyanatobenzoate (CID 23373872) is [4-(4-cyanatobenzoyl)oxyphenyl] 4-cyanatobenzoate.
What is the SMILES notation for [4-(4-cyanatobenzoyl)oxyphenyl] 4-cyanatobenzoate?
The canonical SMILES for [4-(4-cyanatobenzoyl)oxyphenyl] 4-cyanatobenzoate is N#COc1ccc(C(=O)Oc2ccc(OC(=O)c3ccc(OC#N)cc3)cc2)cc1.
What is the InChIKey of [4-(4-cyanatobenzoyl)oxyphenyl] 4-cyanatobenzoate?
The InChIKey is DKLODNBJFDRAIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H12N2O6/c23-13-27-17-5-1-15(2-6-17)21(25)29-19-9-11-20(12-10-19)30-22(26)16-3-7-18(8-4-16)28-14-24/h1-12H.
What are the key properties of [4-(4-cyanatobenzoyl)oxyphenyl] 4-cyanatobenzoate?
[4-(4-cyanatobenzoyl)oxyphenyl] 4-cyanatobenzoate has a molecular weight of 400.35 g/mol, XLogP of 3.84, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-cyanatobenzoyl)oxyphenyl] 4-cyanatobenzoate is sourced from PubChem (CID 23373872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).