[4-[4-(4-cyanatobenzoyl)oxybenzoyl]oxyphenyl]boronic acid

C21H14BNO7 — CID 140945654

IUPAC[4-[4-(4-cyanatobenzoyl)oxybenzoyl]oxyphenyl]boronic acid
SMILESN#COc1ccc(C(=O)Oc2ccc(C(=O)Oc3ccc(B(O)O)cc3)cc2)cc1
InChIInChI=1S/C21H14BNO7/c23-13-28-17-7-1-14(2-8-17)20(24)29-18-9-3-15(4-10-18)21(25)30-19-11-5-16(6-12-19)22(26)27/h1-12,26-27H
InChIKeyMSLCFKWFCBEFCZ-UHFFFAOYSA-N
MW403.16 g/mol
LogP1.66
Rot. Bonds6

About [4-[4-(4-cyanatobenzoyl)oxybenzoyl]oxyphenyl]boronic acid

[4-[4-(4-cyanatobenzoyl)oxybenzoyl]oxyphenyl]boronic acid (PubChem CID 140945654) has the molecular formula C21H14BNO7 and a molecular weight of 403.16 g/mol. Its IUPAC name is [4-[4-(4-cyanatobenzoyl)oxybenzoyl]oxyphenyl]boronic acid.

Molecular Properties

Compound Name[4-[4-(4-cyanatobenzoyl)oxybenzoyl]oxyphenyl]boronic acid
PubChem CID140945654
Molecular FormulaC21H14BNO7
Molecular Weight403.16 g/mol
Exact Mass403.09
IUPAC Name[4-[4-(4-cyanatobenzoyl)oxybenzoyl]oxyphenyl]boronic acid
SMILESN#COc1ccc(C(=O)Oc2ccc(C(=O)Oc3ccc(B(O)O)cc3)cc2)cc1
InChIInChI=1S/C21H14BNO7/c23-13-28-17-7-1-14(2-8-17)20(24)29-18-9-3-15(4-10-18)21(25)30-19-11-5-16(6-12-19)22(26)27/h1-12,26-27H
InChIKeyMSLCFKWFCBEFCZ-UHFFFAOYSA-N
XLogP1.66
TPSA126.08 Ų
H-Bond Donors2
H-Bond Acceptors8
Rotatable Bonds6
Heavy Atoms30
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500403.16
LogP ≤ 51.66
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 108

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}

Analyze [4-[4-(4-cyanatobenzoyl)oxybenzoyl]oxyphenyl]boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [4-[4-(4-cyanatobenzoyl)oxybenzoyl]oxyphenyl]boronic acid?
The IUPAC name of [4-[4-(4-cyanatobenzoyl)oxybenzoyl]oxyphenyl]boronic acid (CID 140945654) is [4-[4-(4-cyanatobenzoyl)oxybenzoyl]oxyphenyl]boronic acid.
What is the SMILES notation for [4-[4-(4-cyanatobenzoyl)oxybenzoyl]oxyphenyl]boronic acid?
The canonical SMILES for [4-[4-(4-cyanatobenzoyl)oxybenzoyl]oxyphenyl]boronic acid is N#COc1ccc(C(=O)Oc2ccc(C(=O)Oc3ccc(B(O)O)cc3)cc2)cc1.
What is the InChIKey of [4-[4-(4-cyanatobenzoyl)oxybenzoyl]oxyphenyl]boronic acid?
The InChIKey is MSLCFKWFCBEFCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H14BNO7/c23-13-28-17-7-1-14(2-8-17)20(24)29-18-9-3-15(4-10-18)21(25)30-19-11-5-16(6-12-19)22(26)27/h1-12,26-27H.
What are the key properties of [4-[4-(4-cyanatobenzoyl)oxybenzoyl]oxyphenyl]boronic acid?
[4-[4-(4-cyanatobenzoyl)oxybenzoyl]oxyphenyl]boronic acid has a molecular weight of 403.16 g/mol, XLogP of 1.66, 6 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[4-(4-cyanatobenzoyl)oxybenzoyl]oxyphenyl]boronic acid is sourced from PubChem (CID 140945654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).