C24H16N2O6 — CID 71341826
bis[4-(cyanatomethyl)phenyl] benzene-1,4-dicarboxylate (PubChem CID 71341826) has the molecular formula C24H16N2O6 and a molecular weight of 428.40 g/mol. Its IUPAC name is bis[4-(cyanatomethyl)phenyl] benzene-1,4-dicarboxylate.
| Compound Name | bis[4-(cyanatomethyl)phenyl] benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 71341826 |
| Molecular Formula | C24H16N2O6 |
| Molecular Weight | 428.40 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | bis[4-(cyanatomethyl)phenyl] benzene-1,4-dicarboxylate |
| SMILES | N#COCc1ccc(OC(=O)c2ccc(C(=O)Oc3ccc(COC#N)cc3)cc2)cc1 |
| InChI | InChI=1S/C24H16N2O6/c25-15-29-13-17-1-9-21(10-2-17)31-23(27)19-5-7-20(8-6-19)24(28)32-22-11-3-18(4-12-22)14-30-16-26/h1-12H,13-14H2 |
| InChIKey | VQNOAXKHWHFLOR-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 118.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.40 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|