C31H34O4 — CID 134200193
2-[4-[1-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]phenyl]-1-[4-(2-hydroxyethoxy)phenyl]ethyl]phenoxy]ethanol (PubChem CID 134200193) has the molecular formula C31H34O4 and a molecular weight of 470.61 g/mol. Its IUPAC name is 2-[4-[1-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]phenyl]-1-[4-(2-hydroxyethoxy)phenyl]ethyl]phenoxy]ethanol.
| Compound Name | 2-[4-[1-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]phenyl]-1-[4-(2-hydroxyethoxy)phenyl]ethyl]phenoxy]ethanol |
|---|---|
| PubChem CID | 134200193 |
| Molecular Formula | C31H34O4 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | 2-[4-[1-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]phenyl]-1-[4-(2-hydroxyethoxy)phenyl]ethyl]phenoxy]ethanol |
| SMILES | C=C/C=C(\C=C/C)c1ccc(C(C)(c2ccc(OCCO)cc2)c2ccc(OCCO)cc2)cc1 |
| InChI | InChI=1S/C31H34O4/c1-4-6-24(7-5-2)25-8-10-26(11-9-25)31(3,27-12-16-29(17-13-27)34-22-20-32)28-14-18-30(19-15-28)35-23-21-33/h4-19,32-33H,1,20-23H2,2-3H3/b7-5-,24-6+ |
| InChIKey | SRPUIDCVKOLQHP-JOMVPBRISA-N |
| XLogP | 5.93 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|