C7H9Cl2N3O2 — CID 154637850
4-amino-2,6-dichlorophenol;urea (PubChem CID 154637850) has the molecular formula C7H9Cl2N3O2 and a molecular weight of 238.07 g/mol. Its IUPAC name is 4-amino-2,6-dichlorophenol;urea.
| Compound Name | 4-amino-2,6-dichlorophenol;urea |
|---|---|
| PubChem CID | 154637850 |
| Molecular Formula | C7H9Cl2N3O2 |
| Molecular Weight | 238.07 g/mol |
| Exact Mass | 237.01 |
| IUPAC Name | 4-amino-2,6-dichlorophenol;urea |
| SMILES | NC(N)=O.Nc1cc(Cl)c(O)c(Cl)c1 |
| InChI | InChI=1S/C6H5Cl2NO.CH4N2O/c7-4-1-3(9)2-5(8)6(4)10;2-1(3)4/h1-2,10H,9H2;(H4,2,3,4) |
| InChIKey | KMSXKVBXGKFXTQ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 115.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.07 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|