C6H4Cl2N2O2 — CID 163301134
4,6-dichloro-5-hydroxypyridine-2-carboxamide (PubChem CID 163301134) has the molecular formula C6H4Cl2N2O2 and a molecular weight of 207.02 g/mol. Its IUPAC name is 4,6-dichloro-5-hydroxypyridine-2-carboxamide.
| Compound Name | 4,6-dichloro-5-hydroxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 163301134 |
| Molecular Formula | C6H4Cl2N2O2 |
| Molecular Weight | 207.02 g/mol |
| Exact Mass | 205.96 |
| IUPAC Name | 4,6-dichloro-5-hydroxypyridine-2-carboxamide |
| SMILES | NC(=O)c1cc(Cl)c(O)c(Cl)n1 |
| InChI | InChI=1S/C6H4Cl2N2O2/c7-2-1-3(6(9)12)10-5(8)4(2)11/h1,11H,(H2,9,12) |
| InChIKey | ZSDPJVPCPUZAEE-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.02 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|