C12H3Cl7N2O3 — CID 157467811
4,5,6-trichloropyridine-2-carbonyl chloride;4,5,6-trichloropyridine-2-carboxylic acid (PubChem CID 157467811) has the molecular formula C12H3Cl7N2O3 and a molecular weight of 471.34 g/mol. Its IUPAC name is 4,5,6-trichloropyridine-2-carbonyl chloride;4,5,6-trichloropyridine-2-carboxylic acid.
| Compound Name | 4,5,6-trichloropyridine-2-carbonyl chloride;4,5,6-trichloropyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 157467811 |
| Molecular Formula | C12H3Cl7N2O3 |
| Molecular Weight | 471.34 g/mol |
| Exact Mass | 467.80 |
| IUPAC Name | 4,5,6-trichloropyridine-2-carbonyl chloride;4,5,6-trichloropyridine-2-carboxylic acid |
| SMILES | O=C(Cl)c1cc(Cl)c(Cl)c(Cl)n1.O=C(O)c1cc(Cl)c(Cl)c(Cl)n1 |
| InChI | InChI=1S/C6HCl4NO.C6H2Cl3NO2/c7-2-1-3(6(10)12)11-5(9)4(2)8;7-2-1-3(6(11)12)10-5(9)4(2)8/h1H;1H,(H,11,12) |
| InChIKey | BURLDSNJESMQNV-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.34 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|