C8H12N2 — CID 142072925
2-N-ethenyl-1-N-[(Z)-prop-1-enyl]propane-1,2-diimine (PubChem CID 142072925) has the molecular formula C8H12N2 and a molecular weight of 136.20 g/mol. Its IUPAC name is 2-N-ethenyl-1-N-[(Z)-prop-1-enyl]propane-1,2-diimine.
| Compound Name | 2-N-ethenyl-1-N-[(Z)-prop-1-enyl]propane-1,2-diimine |
|---|---|
| PubChem CID | 142072925 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | 2-N-ethenyl-1-N-[(Z)-prop-1-enyl]propane-1,2-diimine |
| SMILES | C=C/N=C(C)/C=N/C=C\C |
| InChI | InChI=1S/C8H12N2/c1-4-6-9-7-8(3)10-5-2/h4-7H,2H2,1,3H3/b6-4-,9-7+,10-8+ |
| InChIKey | ABOXKWLRVYOFJW-DILYWIELSA-N |
| XLogP | 2.20 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|