C10H18O3S — CID 142867558
ethane;(3Z,5Z)-4-methylhepta-1,3,5-triene-2-sulfonic acid (PubChem CID 142867558) has the molecular formula C10H18O3S and a molecular weight of 218.32 g/mol. Its IUPAC name is ethane;(3Z,5Z)-4-methylhepta-1,3,5-triene-2-sulfonic acid.
| Compound Name | ethane;(3Z,5Z)-4-methylhepta-1,3,5-triene-2-sulfonic acid |
|---|---|
| PubChem CID | 142867558 |
| Molecular Formula | C10H18O3S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.10 |
| IUPAC Name | ethane;(3Z,5Z)-4-methylhepta-1,3,5-triene-2-sulfonic acid |
| SMILES | C=C(/C=C(C)\C=C/C)S(=O)(=O)O.CC |
| InChI | InChI=1S/C8H12O3S.C2H6/c1-4-5-7(2)6-8(3)12(9,10)11;1-2/h4-6H,3H2,1-2H3,(H,9,10,11);1-2H3/b5-4-,7-6-; |
| InChIKey | KXXFQGMMOPZHQO-CYSANHHKSA-N |
| XLogP | 2.94 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|