About (3E)-hepta-1,3-diene-3-diazonium
(3E)-hepta-1,3-diene-3-diazonium (PubChem CID 143333570) has the molecular formula C7H11N2+
and a molecular weight of 123.18 g/mol. Its IUPAC name is (3E)-hepta-1,3-diene-3-diazonium.
Molecular Properties
| Compound Name | (3E)-hepta-1,3-diene-3-diazonium |
| PubChem CID | 143333570 |
| Molecular Formula | C7H11N2+ |
| Molecular Weight | 123.18 g/mol |
| Exact Mass | 123.09 |
| IUPAC Name | (3E)-hepta-1,3-diene-3-diazonium |
| SMILES | C=C/C(=C\CCC)[N+]#N |
| InChI | InChI=1S/C7H11N2/c1-3-5-6-7(4-2)9-8/h4,6H,2-3,5H2,1H3/q+1/b7-6+ |
| InChIKey | FLJQGOVFEYRXJM-VOTSOKGWSA-N |
| XLogP | 2.71 |
| TPSA | 28.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.18 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-hepta-1,3-diene-3-diazonium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-hepta-1,3-diene-3-diazonium?
The IUPAC name of (3E)-hepta-1,3-diene-3-diazonium (CID 143333570) is (3E)-hepta-1,3-diene-3-diazonium.
What is the SMILES notation for (3E)-hepta-1,3-diene-3-diazonium?
The canonical SMILES for (3E)-hepta-1,3-diene-3-diazonium is C=C/C(=C\CCC)[N+]#N.
What is the InChIKey of (3E)-hepta-1,3-diene-3-diazonium?
The InChIKey is FLJQGOVFEYRXJM-VOTSOKGWSA-N. The full InChI is InChI=1S/C7H11N2/c1-3-5-6-7(4-2)9-8/h4,6H,2-3,5H2,1H3/q+1/b7-6+.
What are the key properties of (3E)-hepta-1,3-diene-3-diazonium?
(3E)-hepta-1,3-diene-3-diazonium has a molecular weight of 123.18 g/mol, XLogP of 2.71, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-hepta-1,3-diene-3-diazonium is sourced from PubChem (CID 143333570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).