C10H15N2+ — CID 123497453
5-ethylideneocta-1,3-diene-3-diazonium (PubChem CID 123497453) has the molecular formula C10H15N2+ and a molecular weight of 163.24 g/mol. Its IUPAC name is 5-ethylideneocta-1,3-diene-3-diazonium.
| Compound Name | 5-ethylideneocta-1,3-diene-3-diazonium |
|---|---|
| PubChem CID | 123497453 |
| Molecular Formula | C10H15N2+ |
| Molecular Weight | 163.24 g/mol |
| Exact Mass | 163.12 |
| IUPAC Name | 5-ethylideneocta-1,3-diene-3-diazonium |
| SMILES | C=CC(=CC(=CC)CCC)[N+]#N |
| InChI | InChI=1S/C10H15N2/c1-4-7-9(5-2)8-10(6-3)12-11/h5-6,8H,3-4,7H2,1-2H3/q+1 |
| InChIKey | WLFFCOIPQSYSRI-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 28.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.24 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|