C6H9N2O+ — CID 11094601
(3E)-4-hydroxyhexa-1,3-diene-3-diazonium (PubChem CID 11094601) has the molecular formula C6H9N2O+ and a molecular weight of 125.15 g/mol. Its IUPAC name is (3E)-4-hydroxyhexa-1,3-diene-3-diazonium.
| Compound Name | (3E)-4-hydroxyhexa-1,3-diene-3-diazonium |
|---|---|
| PubChem CID | 11094601 |
| Molecular Formula | C6H9N2O+ |
| Molecular Weight | 125.15 g/mol |
| Exact Mass | 125.07 |
| IUPAC Name | (3E)-4-hydroxyhexa-1,3-diene-3-diazonium |
| SMILES | C=C/C([N+]#N)=C(\O)CC |
| InChI | InChI=1S/C6H8N2O/c1-3-5(8-7)6(9)4-2/h3H,1,4H2,2H3/p+1/b6-5+ |
| InChIKey | FVKBIPPSMFKRMX-AATRIKPKSA-O |
| XLogP | 2.21 |
| TPSA | 48.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.15 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|