C12H16N3O+ — CID 125476397
(1Z,6E)-1-cyano-2-hydroxy-6,7-dimethylnona-1,6,8-triene-1-diazonium (PubChem CID 125476397) has the molecular formula C12H16N3O+ and a molecular weight of 218.28 g/mol. Its IUPAC name is (1Z,6E)-1-cyano-2-hydroxy-6,7-dimethylnona-1,6,8-triene-1-diazonium.
| Compound Name | (1Z,6E)-1-cyano-2-hydroxy-6,7-dimethylnona-1,6,8-triene-1-diazonium |
|---|---|
| PubChem CID | 125476397 |
| Molecular Formula | C12H16N3O+ |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | (1Z,6E)-1-cyano-2-hydroxy-6,7-dimethylnona-1,6,8-triene-1-diazonium |
| SMILES | C=C/C(C)=C(\C)CCC/C(O)=C(\C#N)[N+]#N |
| InChI | InChI=1S/C12H15N3O/c1-4-9(2)10(3)6-5-7-12(16)11(8-13)15-14/h4H,1,5-7H2,2-3H3/p+1/b10-9+,12-11- |
| InChIKey | ANZPREPPFPLCRS-PVHUKWJHSA-O |
| XLogP | 3.83 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|