C27H42O4 — CID 142024777
(2E,3E)-3-[(4E)-4,5-dimethylhepta-4,6-dienoxy]-2-ethylidene-5-(2-methylidenebut-3-enoxy)hexa-3,5-dienoic acid;ethane;prop-1-ene (PubChem CID 142024777) has the molecular formula C27H42O4 and a molecular weight of 430.63 g/mol. Its IUPAC name is (2E,3E)-3-[(4E)-4,5-dimethylhepta-4,6-dienoxy]-2-ethylidene-5-(2-methylidenebut-3-enoxy)hexa-3,5-dienoic acid;ethane;prop-1-ene.
| Compound Name | (2E,3E)-3-[(4E)-4,5-dimethylhepta-4,6-dienoxy]-2-ethylidene-5-(2-methylidenebut-3-enoxy)hexa-3,5-dienoic acid;ethane;prop-1-ene |
|---|---|
| PubChem CID | 142024777 |
| Molecular Formula | C27H42O4 |
| Molecular Weight | 430.63 g/mol |
| Exact Mass | 430.31 |
| IUPAC Name | (2E,3E)-3-[(4E)-4,5-dimethylhepta-4,6-dienoxy]-2-ethylidene-5-(2-methylidenebut-3-enoxy)hexa-3,5-dienoic acid;ethane;prop-1-ene |
| SMILES | C=CC.C=CC(=C)COC(=C)/C=C(OCCC/C(C)=C(\C)C=C)\C(=C/C)C(=O)O.CC |
| InChI | InChI=1S/C22H30O4.C3H6.C2H6/c1-8-16(4)15-26-19(7)14-21(20(10-3)22(23)24)25-13-11-12-18(6)17(5)9-2;1-3-2;1-2/h8-10,14H,1-2,4,7,11-13,15H2,3,5-6H3,(H,23,24);3H,1H2,2H3;1-2H3/b18-17+,20-10+,21-14+;; |
| InChIKey | IWUDPHSBKZFNHR-OBMXLIPESA-N |
| XLogP | 7.71 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.63 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|