C8H12S2 — CID 89328763
(3Z)-2-(ethyldisulfanyl)hexa-1,3,5-triene (PubChem CID 89328763) has the molecular formula C8H12S2 and a molecular weight of 172.32 g/mol. Its IUPAC name is (3Z)-2-(ethyldisulfanyl)hexa-1,3,5-triene.
| Compound Name | (3Z)-2-(ethyldisulfanyl)hexa-1,3,5-triene |
|---|---|
| PubChem CID | 89328763 |
| Molecular Formula | C8H12S2 |
| Molecular Weight | 172.32 g/mol |
| Exact Mass | 172.04 |
| IUPAC Name | (3Z)-2-(ethyldisulfanyl)hexa-1,3,5-triene |
| SMILES | C=C/C=C\C(=C)SSCC |
| InChI | InChI=1S/C8H12S2/c1-4-6-7-8(3)10-9-5-2/h4,6-7H,1,3,5H2,2H3/b7-6- |
| InChIKey | FIFKNYVMLCTUBF-SREVYHEPSA-N |
| XLogP | 3.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.32 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|