C15H27N5 — CID 163812149
2-(2,4-diaminocyclobutyl)-1-[(4Z,5Z)-4-ethylideneocta-5,7-dien-2-yl]guanidine (PubChem CID 163812149) has the molecular formula C15H27N5 and a molecular weight of 277.42 g/mol. Its IUPAC name is 2-(2,4-diaminocyclobutyl)-1-[(4Z,5Z)-4-ethylideneocta-5,7-dien-2-yl]guanidine.
| Compound Name | 2-(2,4-diaminocyclobutyl)-1-[(4Z,5Z)-4-ethylideneocta-5,7-dien-2-yl]guanidine |
|---|---|
| PubChem CID | 163812149 |
| Molecular Formula | C15H27N5 |
| Molecular Weight | 277.42 g/mol |
| Exact Mass | 277.23 |
| IUPAC Name | 2-(2,4-diaminocyclobutyl)-1-[(4Z,5Z)-4-ethylideneocta-5,7-dien-2-yl]guanidine |
| SMILES | C=C/C=C\C(=C/C)CC(C)N/C(N)=N/C1C(N)CC1N |
| InChI | InChI=1S/C15H27N5/c1-4-6-7-11(5-2)8-10(3)19-15(18)20-14-12(16)9-13(14)17/h4-7,10,12-14H,1,8-9,16-17H2,2-3H3,(H3,18,19,20)/b7-6-,11-5+ |
| InChIKey | NOFGQNQRJIOEOB-TUKAJDRUSA-N |
| XLogP | 0.78 |
| TPSA | 102.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.42 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|