C14H19NO3 — CID 125467212
(2S)-2-[(3,4-dimethoxyphenyl)methyl]pent-4-enamide (PubChem CID 125467212) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is (2S)-2-[(3,4-dimethoxyphenyl)methyl]pent-4-enamide.
| Compound Name | (2S)-2-[(3,4-dimethoxyphenyl)methyl]pent-4-enamide |
|---|---|
| PubChem CID | 125467212 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | (2S)-2-[(3,4-dimethoxyphenyl)methyl]pent-4-enamide |
| SMILES | C=CC[C@@H](Cc1ccc(OC)c(OC)c1)C(N)=O |
| InChI | InChI=1S/C14H19NO3/c1-4-5-11(14(15)16)8-10-6-7-12(17-2)13(9-10)18-3/h4,6-7,9,11H,1,5,8H2,2-3H3,(H2,15,16)/t11-/m0/s1 |
| InChIKey | ONBVUGKDSVSXSV-NSHDSACASA-N |
| XLogP | 1.92 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|