C16H20O5 — CID 149406370
prop-2-enyl 2-hydroxy-3-(4-methoxy-3-prop-2-enoxyphenyl)propanoate (PubChem CID 149406370) has the molecular formula C16H20O5 and a molecular weight of 292.33 g/mol. Its IUPAC name is prop-2-enyl 2-hydroxy-3-(4-methoxy-3-prop-2-enoxyphenyl)propanoate.
| Compound Name | prop-2-enyl 2-hydroxy-3-(4-methoxy-3-prop-2-enoxyphenyl)propanoate |
|---|---|
| PubChem CID | 149406370 |
| Molecular Formula | C16H20O5 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | prop-2-enyl 2-hydroxy-3-(4-methoxy-3-prop-2-enoxyphenyl)propanoate |
| SMILES | C=CCOC(=O)C(O)Cc1ccc(OC)c(OCC=C)c1 |
| InChI | InChI=1S/C16H20O5/c1-4-8-20-15-11-12(6-7-14(15)19-3)10-13(17)16(18)21-9-5-2/h4-7,11,13,17H,1-2,8-10H2,3H3 |
| InChIKey | YQJJLYYHZYEVDF-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|