C11H14O3 — CID 28562283
(4-methoxy-3-prop-2-enoxyphenyl)methanol (PubChem CID 28562283) has the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. Its IUPAC name is (4-methoxy-3-prop-2-enoxyphenyl)methanol.
| Compound Name | (4-methoxy-3-prop-2-enoxyphenyl)methanol |
|---|---|
| PubChem CID | 28562283 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | (4-methoxy-3-prop-2-enoxyphenyl)methanol |
| SMILES | C=CCOc1cc(CO)ccc1OC |
| InChI | InChI=1S/C11H14O3/c1-3-6-14-11-7-9(8-12)4-5-10(11)13-2/h3-5,7,12H,1,6,8H2,2H3 |
| InChIKey | GCFBLKUPILHINH-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|