methyl 4-(3,4-dimethoxyphenyl)-3-(prop-2-enylamino)butanoate

C16H23NO4 — CID 82351430

IUPACmethyl 4-(3,4-dimethoxyphenyl)-3-(prop-2-enylamino)butanoate
SMILESC=CCNC(CC(=O)OC)Cc1ccc(OC)c(OC)c1
InChIInChI=1S/C16H23NO4/c1-5-8-17-13(11-16(18)21-4)9-12-6-7-14(19-2)15(10-12)20-3/h5-7,10,13,17H,1,8-9,11H2,2-4H3
InChIKeyDTZXKBSRZGRRAF-UHFFFAOYSA-N
MW293.36 g/mol
LogP1.95
Rot. Bonds9

About methyl 4-(3,4-dimethoxyphenyl)-3-(prop-2-enylamino)butanoate

methyl 4-(3,4-dimethoxyphenyl)-3-(prop-2-enylamino)butanoate (PubChem CID 82351430) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is methyl 4-(3,4-dimethoxyphenyl)-3-(prop-2-enylamino)butanoate.

Molecular Properties

Compound Namemethyl 4-(3,4-dimethoxyphenyl)-3-(prop-2-enylamino)butanoate
PubChem CID82351430
Molecular FormulaC16H23NO4
Molecular Weight293.36 g/mol
Exact Mass293.16
IUPAC Namemethyl 4-(3,4-dimethoxyphenyl)-3-(prop-2-enylamino)butanoate
SMILESC=CCNC(CC(=O)OC)Cc1ccc(OC)c(OC)c1
InChIInChI=1S/C16H23NO4/c1-5-8-17-13(11-16(18)21-4)9-12-6-7-14(19-2)15(10-12)20-3/h5-7,10,13,17H,1,8-9,11H2,2-4H3
InChIKeyDTZXKBSRZGRRAF-UHFFFAOYSA-N
XLogP1.95
TPSA56.79 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds9
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500293.36
LogP ≤ 51.95
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze methyl 4-(3,4-dimethoxyphenyl)-3-(prop-2-enylamino)butanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-(3,4-dimethoxyphenyl)-3-(prop-2-enylamino)butanoate?
The IUPAC name of methyl 4-(3,4-dimethoxyphenyl)-3-(prop-2-enylamino)butanoate (CID 82351430) is methyl 4-(3,4-dimethoxyphenyl)-3-(prop-2-enylamino)butanoate.
What is the SMILES notation for methyl 4-(3,4-dimethoxyphenyl)-3-(prop-2-enylamino)butanoate?
The canonical SMILES for methyl 4-(3,4-dimethoxyphenyl)-3-(prop-2-enylamino)butanoate is C=CCNC(CC(=O)OC)Cc1ccc(OC)c(OC)c1.
What is the InChIKey of methyl 4-(3,4-dimethoxyphenyl)-3-(prop-2-enylamino)butanoate?
The InChIKey is DTZXKBSRZGRRAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO4/c1-5-8-17-13(11-16(18)21-4)9-12-6-7-14(19-2)15(10-12)20-3/h5-7,10,13,17H,1,8-9,11H2,2-4H3.
What are the key properties of methyl 4-(3,4-dimethoxyphenyl)-3-(prop-2-enylamino)butanoate?
methyl 4-(3,4-dimethoxyphenyl)-3-(prop-2-enylamino)butanoate has a molecular weight of 293.36 g/mol, XLogP of 1.95, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(3,4-dimethoxyphenyl)-3-(prop-2-enylamino)butanoate is sourced from PubChem (CID 82351430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).