C16H23NO4 — CID 82351430
methyl 4-(3,4-dimethoxyphenyl)-3-(prop-2-enylamino)butanoate (PubChem CID 82351430) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is methyl 4-(3,4-dimethoxyphenyl)-3-(prop-2-enylamino)butanoate.
| Compound Name | methyl 4-(3,4-dimethoxyphenyl)-3-(prop-2-enylamino)butanoate |
|---|---|
| PubChem CID | 82351430 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | methyl 4-(3,4-dimethoxyphenyl)-3-(prop-2-enylamino)butanoate |
| SMILES | C=CCNC(CC(=O)OC)Cc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C16H23NO4/c1-5-8-17-13(11-16(18)21-4)9-12-6-7-14(19-2)15(10-12)20-3/h5-7,10,13,17H,1,8-9,11H2,2-4H3 |
| InChIKey | DTZXKBSRZGRRAF-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|