C17H25NO5 — CID 110476823
methyl 3-[3-(3,4-dimethoxyphenyl)propanoylamino]pentanoate (PubChem CID 110476823) has the molecular formula C17H25NO5 and a molecular weight of 323.39 g/mol. Its IUPAC name is methyl 3-[3-(3,4-dimethoxyphenyl)propanoylamino]pentanoate.
| Compound Name | methyl 3-[3-(3,4-dimethoxyphenyl)propanoylamino]pentanoate |
|---|---|
| PubChem CID | 110476823 |
| Molecular Formula | C17H25NO5 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | methyl 3-[3-(3,4-dimethoxyphenyl)propanoylamino]pentanoate |
| SMILES | CCC(CC(=O)OC)NC(=O)CCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C17H25NO5/c1-5-13(11-17(20)23-4)18-16(19)9-7-12-6-8-14(21-2)15(10-12)22-3/h6,8,10,13H,5,7,9,11H2,1-4H3,(H,18,19) |
| InChIKey | LBDCBZONGRPWPT-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |