C15H18O5 — CID 10956821
3-[3,4-bis(prop-2-enoxy)phenyl]-2-hydroxypropanoic acid (PubChem CID 10956821) has the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. Its IUPAC name is 3-[3,4-bis(prop-2-enoxy)phenyl]-2-hydroxypropanoic acid.
| Compound Name | 3-[3,4-bis(prop-2-enoxy)phenyl]-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 10956821 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 3-[3,4-bis(prop-2-enoxy)phenyl]-2-hydroxypropanoic acid |
| SMILES | C=CCOc1ccc(CC(O)C(=O)O)cc1OCC=C |
| InChI | InChI=1S/C15H18O5/c1-3-7-19-13-6-5-11(9-12(16)15(17)18)10-14(13)20-8-4-2/h3-6,10,12,16H,1-2,7-9H2,(H,17,18) |
| InChIKey | GEHJEGRJNQSTHX-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|