C13H14O6 — CID 67378095
2-[2-(carboxymethoxy)-4-prop-2-enylphenoxy]acetic acid (PubChem CID 67378095) has the molecular formula C13H14O6 and a molecular weight of 266.25 g/mol. Its IUPAC name is 2-[2-(carboxymethoxy)-4-prop-2-enylphenoxy]acetic acid.
| Compound Name | 2-[2-(carboxymethoxy)-4-prop-2-enylphenoxy]acetic acid |
|---|---|
| PubChem CID | 67378095 |
| Molecular Formula | C13H14O6 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 2-[2-(carboxymethoxy)-4-prop-2-enylphenoxy]acetic acid |
| SMILES | C=CCc1ccc(OCC(=O)O)c(OCC(=O)O)c1 |
| InChI | InChI=1S/C13H14O6/c1-2-3-9-4-5-10(18-7-12(14)15)11(6-9)19-8-13(16)17/h2,4-6H,1,3,7-8H2,(H,14,15)(H,16,17) |
| InChIKey | QSNRJSXJVKHDBM-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|