C18H27NO3 — CID 3026092
N,N-diethyl-2-(4-prop-2-enyl-2-propoxyphenoxy)acetamide (PubChem CID 3026092) has the molecular formula C18H27NO3 and a molecular weight of 305.42 g/mol. Its IUPAC name is N,N-diethyl-2-(4-prop-2-enyl-2-propoxyphenoxy)acetamide.
| Compound Name | N,N-diethyl-2-(4-prop-2-enyl-2-propoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 3026092 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | N,N-diethyl-2-(4-prop-2-enyl-2-propoxyphenoxy)acetamide |
| SMILES | C=CCc1ccc(OCC(=O)N(CC)CC)c(OCCC)c1 |
| InChI | InChI=1S/C18H27NO3/c1-5-9-15-10-11-16(17(13-15)21-12-6-2)22-14-18(20)19(7-3)8-4/h5,10-11,13H,1,6-9,12,14H2,2-4H3 |
| InChIKey | UDUHHMYWHMCWLB-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|