C22H35NO5 — CID 11574730
propyl 2-[4-[2-(dipropylamino)-2-oxoethoxy]-3-propoxyphenyl]acetate (PubChem CID 11574730) has the molecular formula C22H35NO5 and a molecular weight of 393.52 g/mol. Its IUPAC name is propyl 2-[4-[2-(dipropylamino)-2-oxoethoxy]-3-propoxyphenyl]acetate.
| Compound Name | propyl 2-[4-[2-(dipropylamino)-2-oxoethoxy]-3-propoxyphenyl]acetate |
|---|---|
| PubChem CID | 11574730 |
| Molecular Formula | C22H35NO5 |
| Molecular Weight | 393.52 g/mol |
| Exact Mass | 393.25 |
| IUPAC Name | propyl 2-[4-[2-(dipropylamino)-2-oxoethoxy]-3-propoxyphenyl]acetate |
| SMILES | CCCOC(=O)Cc1ccc(OCC(=O)N(CCC)CCC)c(OCCC)c1 |
| InChI | InChI=1S/C22H35NO5/c1-5-11-23(12-6-2)21(24)17-28-19-10-9-18(15-20(19)26-13-7-3)16-22(25)27-14-8-4/h9-10,15H,5-8,11-14,16-17H2,1-4H3 |
| InChIKey | BBZKIWNIBAJUKW-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.52 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |