C21H33NO6 — CID 67199986
propyl 2-[4-[2-[ethyl(propyl)amino]-2-oxoethoxy]-3-propoxyphenyl]-2-hydroxyacetate (PubChem CID 67199986) has the molecular formula C21H33NO6 and a molecular weight of 395.50 g/mol. Its IUPAC name is propyl 2-[4-[2-[ethyl(propyl)amino]-2-oxoethoxy]-3-propoxyphenyl]-2-hydroxyacetate.
| Compound Name | propyl 2-[4-[2-[ethyl(propyl)amino]-2-oxoethoxy]-3-propoxyphenyl]-2-hydroxyacetate |
|---|---|
| PubChem CID | 67199986 |
| Molecular Formula | C21H33NO6 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | propyl 2-[4-[2-[ethyl(propyl)amino]-2-oxoethoxy]-3-propoxyphenyl]-2-hydroxyacetate |
| SMILES | CCCOC(=O)C(O)c1ccc(OCC(=O)N(CC)CCC)c(OCCC)c1 |
| InChI | InChI=1S/C21H33NO6/c1-5-11-22(8-4)19(23)15-28-17-10-9-16(14-18(17)26-12-6-2)20(24)21(25)27-13-7-3/h9-10,14,20,24H,5-8,11-13,15H2,1-4H3 |
| InChIKey | TVSVZXBXOVEEMF-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |