C21H22ClNO5 — CID 2526838
(3R)-3-(4-chlorophenyl)-3-[[2-(2-methoxy-4-prop-2-enylphenoxy)acetyl]amino]propanoic acid (PubChem CID 2526838) has the molecular formula C21H22ClNO5 and a molecular weight of 403.86 g/mol. Its IUPAC name is (3R)-3-(4-chlorophenyl)-3-[[2-(2-methoxy-4-prop-2-enylphenoxy)acetyl]amino]propanoic acid.
| Compound Name | (3R)-3-(4-chlorophenyl)-3-[[2-(2-methoxy-4-prop-2-enylphenoxy)acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 2526838 |
| Molecular Formula | C21H22ClNO5 |
| Molecular Weight | 403.86 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | (3R)-3-(4-chlorophenyl)-3-[[2-(2-methoxy-4-prop-2-enylphenoxy)acetyl]amino]propanoic acid |
| SMILES | C=CCc1ccc(OCC(=O)N[C@H](CC(=O)O)c2ccc(Cl)cc2)c(OC)c1 |
| InChI | InChI=1S/C21H22ClNO5/c1-3-4-14-5-10-18(19(11-14)27-2)28-13-20(24)23-17(12-21(25)26)15-6-8-16(22)9-7-15/h3,5-11,17H,1,4,12-13H2,2H3,(H,23,24)(H,25,26)/t17-/m1/s1 |
| InChIKey | BMGAVDIACUBBIR-QGZVFWFLSA-N |
| XLogP | 3.79 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.86 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|