C21H22F2N2O4 — CID 78834446
2-(3,4-difluorophenyl)-2-[[2-(2-methoxy-4-prop-2-enylphenoxy)acetyl]amino]-N-methylacetamide (PubChem CID 78834446) has the molecular formula C21H22F2N2O4 and a molecular weight of 404.41 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-2-[[2-(2-methoxy-4-prop-2-enylphenoxy)acetyl]amino]-N-methylacetamide.
| Compound Name | 2-(3,4-difluorophenyl)-2-[[2-(2-methoxy-4-prop-2-enylphenoxy)acetyl]amino]-N-methylacetamide |
|---|---|
| PubChem CID | 78834446 |
| Molecular Formula | C21H22F2N2O4 |
| Molecular Weight | 404.41 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 2-(3,4-difluorophenyl)-2-[[2-(2-methoxy-4-prop-2-enylphenoxy)acetyl]amino]-N-methylacetamide |
| SMILES | C=CCc1ccc(OCC(=O)NC(C(=O)NC)c2ccc(F)c(F)c2)c(OC)c1 |
| InChI | InChI=1S/C21H22F2N2O4/c1-4-5-13-6-9-17(18(10-13)28-3)29-12-19(26)25-20(21(27)24-2)14-7-8-15(22)16(23)11-14/h4,6-11,20H,1,5,12H2,2-3H3,(H,24,27)(H,25,26) |
| InChIKey | FPPLIEGIJVVMRE-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.41 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|