C20H30O — CID 123670154
1-[6-methyl-5-(3-methyl-4-prop-2-enylhepta-2,5-dien-2-yl)cyclohex-3-en-1-yl]ethanone (PubChem CID 123670154) has the molecular formula C20H30O and a molecular weight of 286.46 g/mol. Its IUPAC name is 1-[6-methyl-5-(3-methyl-4-prop-2-enylhepta-2,5-dien-2-yl)cyclohex-3-en-1-yl]ethanone.
| Compound Name | 1-[6-methyl-5-(3-methyl-4-prop-2-enylhepta-2,5-dien-2-yl)cyclohex-3-en-1-yl]ethanone |
|---|---|
| PubChem CID | 123670154 |
| Molecular Formula | C20H30O |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | 1-[6-methyl-5-(3-methyl-4-prop-2-enylhepta-2,5-dien-2-yl)cyclohex-3-en-1-yl]ethanone |
| SMILES | C=CCC(C=CC)C(C)=C(C)C1C=CCC(C(C)=O)C1C |
| InChI | InChI=1S/C20H30O/c1-7-10-18(11-8-2)14(3)15(4)19-12-9-13-20(16(19)5)17(6)21/h7-9,11-12,16,18-20H,1,10,13H2,2-6H3 |
| InChIKey | UWVHCVPAZUORJB-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|