C21H30O6 — CID 101024375
[(1R)-1-[(3aS,4S,8S,8aR)-4-[(1R)-1-acetyloxyprop-2-enyl]-2,2-dimethyl-4,7,8,8a-tetrahydro-3aH-cyclohepta[d][1,3]dioxol-8-yl]but-3-enyl] acetate (PubChem CID 101024375) has the molecular formula C21H30O6 and a molecular weight of 378.47 g/mol. Its IUPAC name is [(1R)-1-[(3aS,4S,8S,8aR)-4-[(1R)-1-acetyloxyprop-2-enyl]-2,2-dimethyl-4,7,8,8a-tetrahydro-3aH-cyclohepta[d][1,3]dioxol-8-yl]but-3-enyl] acetate.
| Compound Name | [(1R)-1-[(3aS,4S,8S,8aR)-4-[(1R)-1-acetyloxyprop-2-enyl]-2,2-dimethyl-4,7,8,8a-tetrahydro-3aH-cyclohepta[d][1,3]dioxol-8-yl]but-3-enyl] acetate |
|---|---|
| PubChem CID | 101024375 |
| Molecular Formula | C21H30O6 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | [(1R)-1-[(3aS,4S,8S,8aR)-4-[(1R)-1-acetyloxyprop-2-enyl]-2,2-dimethyl-4,7,8,8a-tetrahydro-3aH-cyclohepta[d][1,3]dioxol-8-yl]but-3-enyl] acetate |
| SMILES | C=CC[C@@H](OC(C)=O)[C@@H]1CC=C[C@@H]([C@@H](C=C)OC(C)=O)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C21H30O6/c1-7-10-18(25-14(4)23)16-12-9-11-15(17(8-2)24-13(3)22)19-20(16)27-21(5,6)26-19/h7-9,11,15-20H,1-2,10,12H2,3-6H3/t15-,16-,17+,18+,19-,20+/m0/s1 |
| InChIKey | RVLSGIXKJHWBJK-YDETXVTLSA-N |
| XLogP | 3.32 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|