C12H16O2 — CID 638928
[(1S)-1-[(1S,5S)-5-ethenylcyclopent-2-en-1-yl]prop-2-enyl] acetate (PubChem CID 638928) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is [(1S)-1-[(1S,5S)-5-ethenylcyclopent-2-en-1-yl]prop-2-enyl] acetate.
| Compound Name | [(1S)-1-[(1S,5S)-5-ethenylcyclopent-2-en-1-yl]prop-2-enyl] acetate |
|---|---|
| PubChem CID | 638928 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | [(1S)-1-[(1S,5S)-5-ethenylcyclopent-2-en-1-yl]prop-2-enyl] acetate |
| SMILES | C=C[C@@H]1CC=C[C@@H]1[C@H](C=C)OC(C)=O |
| InChI | InChI=1S/C12H16O2/c1-4-10-7-6-8-11(10)12(5-2)14-9(3)13/h4-6,8,10-12H,1-2,7H2,3H3/t10-,11+,12+/m1/s1 |
| InChIKey | UGXVSFOECMBEPK-WOPDTQHZSA-N |
| XLogP | 2.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|