C10H15NO — CID 139331983
(5R,6Z)-5-isocyanato-4-methylocta-1,6-diene (PubChem CID 139331983) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is (5R,6Z)-5-isocyanato-4-methylocta-1,6-diene.
| Compound Name | (5R,6Z)-5-isocyanato-4-methylocta-1,6-diene |
|---|---|
| PubChem CID | 139331983 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | (5R,6Z)-5-isocyanato-4-methylocta-1,6-diene |
| SMILES | C=CCC(C)[C@H](/C=C\C)N=C=O |
| InChI | InChI=1S/C10H15NO/c1-4-6-9(3)10(7-5-2)11-8-12/h4-5,7,9-10H,1,6H2,2-3H3/b7-5-/t9?,10-/m0/s1 |
| InChIKey | QTCOFWVDYADBQD-NTRGLEALSA-N |
| XLogP | 2.48 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|