C12H20S — CID 138486158
(3E,5S)-7-methyl-5-prop-2-enylocta-3,7-diene-1-thiol (PubChem CID 138486158) has the molecular formula C12H20S and a molecular weight of 196.36 g/mol. Its IUPAC name is (3E,5S)-7-methyl-5-prop-2-enylocta-3,7-diene-1-thiol.
| Compound Name | (3E,5S)-7-methyl-5-prop-2-enylocta-3,7-diene-1-thiol |
|---|---|
| PubChem CID | 138486158 |
| Molecular Formula | C12H20S |
| Molecular Weight | 196.36 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | (3E,5S)-7-methyl-5-prop-2-enylocta-3,7-diene-1-thiol |
| SMILES | C=CC[C@H](/C=C/CCS)CC(=C)C |
| InChI | InChI=1S/C12H20S/c1-4-7-12(10-11(2)3)8-5-6-9-13/h4-5,8,12-13H,1-2,6-7,9-10H2,3H3/b8-5+/t12-/m1/s1 |
| InChIKey | AFBYYQPNQPEDOX-FZKGZDJFSA-N |
| XLogP | 4.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.36 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|