C11H20N2 — CID 100988531
(5Z)-2-methyldeca-1,5,9-triene-4,7-diamine (PubChem CID 100988531) has the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. Its IUPAC name is (5Z)-2-methyldeca-1,5,9-triene-4,7-diamine.
| Compound Name | (5Z)-2-methyldeca-1,5,9-triene-4,7-diamine |
|---|---|
| PubChem CID | 100988531 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | (5Z)-2-methyldeca-1,5,9-triene-4,7-diamine |
| SMILES | C=CCC(N)/C=C\C(N)CC(=C)C |
| InChI | InChI=1S/C11H20N2/c1-4-5-10(12)6-7-11(13)8-9(2)3/h4,6-7,10-11H,1-2,5,8,12-13H2,3H3/b7-6- |
| InChIKey | QMEFCNUWNCICSW-SREVYHEPSA-N |
| XLogP | 1.74 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|