About (2S)-N'-ethyl-3-(2-methylprop-2-enyl)-2-prop-2-enylbutanediamide
(2S)-N'-ethyl-3-(2-methylprop-2-enyl)-2-prop-2-enylbutanediamide (PubChem CID 89200891) has the molecular formula C13H22N2O2
and a molecular weight of 238.33 g/mol. Its IUPAC name is (2S)-N'-ethyl-3-(2-methylprop-2-enyl)-2-prop-2-enylbutanediamide.
Molecular Properties
| Compound Name | (2S)-N'-ethyl-3-(2-methylprop-2-enyl)-2-prop-2-enylbutanediamide |
| PubChem CID | 89200891 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | (2S)-N'-ethyl-3-(2-methylprop-2-enyl)-2-prop-2-enylbutanediamide |
| SMILES | C=CC[C@H](C(N)=O)C(CC(=C)C)C(=O)NCC |
| InChI | InChI=1S/C13H22N2O2/c1-5-7-10(12(14)16)11(8-9(3)4)13(17)15-6-2/h5,10-11H,1,3,6-8H2,2,4H3,(H2,14,16)(H,15,17)/t10-,11?/m0/s1 |
| InChIKey | GXOGLXJEYVLIFW-VUWPPUDQSA-N |
| XLogP | 1.38 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S)-N'-ethyl-3-(2-methylprop-2-enyl)-2-prop-2-enylbutanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N'-ethyl-3-(2-methylprop-2-enyl)-2-prop-2-enylbutanediamide?
The IUPAC name of (2S)-N'-ethyl-3-(2-methylprop-2-enyl)-2-prop-2-enylbutanediamide (CID 89200891) is (2S)-N'-ethyl-3-(2-methylprop-2-enyl)-2-prop-2-enylbutanediamide.
What is the SMILES notation for (2S)-N'-ethyl-3-(2-methylprop-2-enyl)-2-prop-2-enylbutanediamide?
The canonical SMILES for (2S)-N'-ethyl-3-(2-methylprop-2-enyl)-2-prop-2-enylbutanediamide is C=CC[C@H](C(N)=O)C(CC(=C)C)C(=O)NCC.
What is the InChIKey of (2S)-N'-ethyl-3-(2-methylprop-2-enyl)-2-prop-2-enylbutanediamide?
The InChIKey is GXOGLXJEYVLIFW-VUWPPUDQSA-N. The full InChI is InChI=1S/C13H22N2O2/c1-5-7-10(12(14)16)11(8-9(3)4)13(17)15-6-2/h5,10-11H,1,3,6-8H2,2,4H3,(H2,14,16)(H,15,17)/t10-,11?/m0/s1.
What are the key properties of (2S)-N'-ethyl-3-(2-methylprop-2-enyl)-2-prop-2-enylbutanediamide?
(2S)-N'-ethyl-3-(2-methylprop-2-enyl)-2-prop-2-enylbutanediamide has a molecular weight of 238.33 g/mol, XLogP of 1.38, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N'-ethyl-3-(2-methylprop-2-enyl)-2-prop-2-enylbutanediamide is sourced from PubChem (CID 89200891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).