C10H18N2O2 — CID 142005655
N',2-dimethyl-3-(2-methylprop-2-enyl)butanediamide (PubChem CID 142005655) has the molecular formula C10H18N2O2 and a molecular weight of 198.27 g/mol. Its IUPAC name is N',2-dimethyl-3-(2-methylprop-2-enyl)butanediamide.
| Compound Name | N',2-dimethyl-3-(2-methylprop-2-enyl)butanediamide |
|---|---|
| PubChem CID | 142005655 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | N',2-dimethyl-3-(2-methylprop-2-enyl)butanediamide |
| SMILES | C=C(C)CC(C(=O)NC)C(C)C(N)=O |
| InChI | InChI=1S/C10H18N2O2/c1-6(2)5-8(10(14)12-4)7(3)9(11)13/h7-8H,1,5H2,2-4H3,(H2,11,13)(H,12,14) |
| InChIKey | OMDGXRXOWCGEGZ-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|