C13H24N2O2 — CID 154531690
(2S)-2-butyl-N'-methyl-3-(2-methylprop-2-enyl)butanediamide (PubChem CID 154531690) has the molecular formula C13H24N2O2 and a molecular weight of 240.35 g/mol. Its IUPAC name is (2S)-2-butyl-N'-methyl-3-(2-methylprop-2-enyl)butanediamide.
| Compound Name | (2S)-2-butyl-N'-methyl-3-(2-methylprop-2-enyl)butanediamide |
|---|---|
| PubChem CID | 154531690 |
| Molecular Formula | C13H24N2O2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.18 |
| IUPAC Name | (2S)-2-butyl-N'-methyl-3-(2-methylprop-2-enyl)butanediamide |
| SMILES | C=C(C)CC(C(=O)NC)[C@H](CCCC)C(N)=O |
| InChI | InChI=1S/C13H24N2O2/c1-5-6-7-10(12(14)16)11(8-9(2)3)13(17)15-4/h10-11H,2,5-8H2,1,3-4H3,(H2,14,16)(H,15,17)/t10-,11?/m0/s1 |
| InChIKey | LXIYKVVVNCMVNO-VUWPPUDQSA-N |
| XLogP | 1.61 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|