C15H30N2O2 — CID 22972676
N'-tert-butyl-2-butyl-3-propan-2-ylbutanediamide (PubChem CID 22972676) has the molecular formula C15H30N2O2 and a molecular weight of 270.42 g/mol. Its IUPAC name is N'-tert-butyl-2-butyl-3-propan-2-ylbutanediamide.
| Compound Name | N'-tert-butyl-2-butyl-3-propan-2-ylbutanediamide |
|---|---|
| PubChem CID | 22972676 |
| Molecular Formula | C15H30N2O2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.23 |
| IUPAC Name | N'-tert-butyl-2-butyl-3-propan-2-ylbutanediamide |
| SMILES | CCCCC(C(N)=O)C(C(=O)NC(C)(C)C)C(C)C |
| InChI | InChI=1S/C15H30N2O2/c1-7-8-9-11(13(16)18)12(10(2)3)14(19)17-15(4,5)6/h10-12H,7-9H2,1-6H3,(H2,16,18)(H,17,19) |
| InChIKey | OTCUNAUKDHGSPZ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |