C18H34N2O2 — CID 22972622
N'-tert-butyl-2-(2-cyclopentylethyl)-3-propan-2-ylbutanediamide (PubChem CID 22972622) has the molecular formula C18H34N2O2 and a molecular weight of 310.48 g/mol. Its IUPAC name is N'-tert-butyl-2-(2-cyclopentylethyl)-3-propan-2-ylbutanediamide.
| Compound Name | N'-tert-butyl-2-(2-cyclopentylethyl)-3-propan-2-ylbutanediamide |
|---|---|
| PubChem CID | 22972622 |
| Molecular Formula | C18H34N2O2 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.26 |
| IUPAC Name | N'-tert-butyl-2-(2-cyclopentylethyl)-3-propan-2-ylbutanediamide |
| SMILES | CC(C)C(C(=O)NC(C)(C)C)C(CCC1CCCC1)C(N)=O |
| InChI | InChI=1S/C18H34N2O2/c1-12(2)15(17(22)20-18(3,4)5)14(16(19)21)11-10-13-8-6-7-9-13/h12-15H,6-11H2,1-5H3,(H2,19,21)(H,20,22) |
| InChIKey | LMUVSQRAFFQRRT-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |