C17H32N2O2 — CID 22972628
N'-tert-butyl-2-(2-cyclopropylethyl)-3-(2-methylpropyl)butanediamide (PubChem CID 22972628) has the molecular formula C17H32N2O2 and a molecular weight of 296.46 g/mol. Its IUPAC name is N'-tert-butyl-2-(2-cyclopropylethyl)-3-(2-methylpropyl)butanediamide.
| Compound Name | N'-tert-butyl-2-(2-cyclopropylethyl)-3-(2-methylpropyl)butanediamide |
|---|---|
| PubChem CID | 22972628 |
| Molecular Formula | C17H32N2O2 |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | N'-tert-butyl-2-(2-cyclopropylethyl)-3-(2-methylpropyl)butanediamide |
| SMILES | CC(C)CC(C(=O)NC(C)(C)C)C(CCC1CC1)C(N)=O |
| InChI | InChI=1S/C17H32N2O2/c1-11(2)10-14(16(21)19-17(3,4)5)13(15(18)20)9-8-12-6-7-12/h11-14H,6-10H2,1-5H3,(H2,18,20)(H,19,21) |
| InChIKey | YQULIZADSRKMLW-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |