C13H23IN2O2 — CID 142005684
(2S)-2-butyl-3-(cyclobutylmethyl)-N'-iodobutanediamide (PubChem CID 142005684) has the molecular formula C13H23IN2O2 and a molecular weight of 366.24 g/mol. Its IUPAC name is (2S)-2-butyl-3-(cyclobutylmethyl)-N'-iodobutanediamide.
| Compound Name | (2S)-2-butyl-3-(cyclobutylmethyl)-N'-iodobutanediamide |
|---|---|
| PubChem CID | 142005684 |
| Molecular Formula | C13H23IN2O2 |
| Molecular Weight | 366.24 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | (2S)-2-butyl-3-(cyclobutylmethyl)-N'-iodobutanediamide |
| SMILES | CCCC[C@H](C(N)=O)C(CC1CCC1)C(=O)NI |
| InChI | InChI=1S/C13H23IN2O2/c1-2-3-7-10(12(15)17)11(13(18)16-14)8-9-5-4-6-9/h9-11H,2-8H2,1H3,(H2,15,17)(H,16,18)/t10-,11?/m0/s1 |
| InChIKey | JSRKDLRPBHDCJK-VUWPPUDQSA-N |
| XLogP | 2.55 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.24 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|