C8H17Br2N — CID 174746047
azane;4-bromo-6-methylhepta-1,5-diene;hydrobromide (PubChem CID 174746047) has the molecular formula C8H17Br2N and a molecular weight of 287.04 g/mol. Its IUPAC name is azane;4-bromo-6-methylhepta-1,5-diene;hydrobromide.
| Compound Name | azane;4-bromo-6-methylhepta-1,5-diene;hydrobromide |
|---|---|
| PubChem CID | 174746047 |
| Molecular Formula | C8H17Br2N |
| Molecular Weight | 287.04 g/mol |
| Exact Mass | 284.97 |
| IUPAC Name | azane;4-bromo-6-methylhepta-1,5-diene;hydrobromide |
| SMILES | Br.C=CCC(Br)C=C(C)C.N |
| InChI | InChI=1S/C8H13Br.BrH.H3N/c1-4-5-8(9)6-7(2)3;;/h4,6,8H,1,5H2,2-3H3;1H;1H3 |
| InChIKey | ZNCYUUBZYNIHEE-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 35.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.04 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|