C12H19ClO — CID 174646215
3-hexa-1,5-dien-3-yloxyhexa-1,5-diene;hydrochloride (PubChem CID 174646215) has the molecular formula C12H19ClO and a molecular weight of 214.74 g/mol. Its IUPAC name is 3-hexa-1,5-dien-3-yloxyhexa-1,5-diene;hydrochloride.
| Compound Name | 3-hexa-1,5-dien-3-yloxyhexa-1,5-diene;hydrochloride |
|---|---|
| PubChem CID | 174646215 |
| Molecular Formula | C12H19ClO |
| Molecular Weight | 214.74 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 3-hexa-1,5-dien-3-yloxyhexa-1,5-diene;hydrochloride |
| SMILES | C=CCC(C=C)OC(C=C)CC=C.Cl |
| InChI | InChI=1S/C12H18O.ClH/c1-5-9-11(7-3)13-12(8-4)10-6-2;/h5-8,11-12H,1-4,9-10H2;1H |
| InChIKey | AXNVJQDROUVSGF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.74 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|