About hexa-1,5-dien-3-olate
hexa-1,5-dien-3-olate (PubChem CID 101095679) has the molecular formula C6H9O-
and a molecular weight of 97.14 g/mol. Its IUPAC name is hexa-1,5-dien-3-olate.
Molecular Properties
| Compound Name | hexa-1,5-dien-3-olate |
| PubChem CID | 101095679 |
| Molecular Formula | C6H9O- |
| Molecular Weight | 97.14 g/mol |
| Exact Mass | 97.07 |
| IUPAC Name | hexa-1,5-dien-3-olate |
| SMILES | C=CCC([O-])C=C |
| InChI | InChI=1S/C6H9O/c1-3-5-6(7)4-2/h3-4,6H,1-2,5H2/q-1 |
| InChIKey | WDOYVYLQROTWRK-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 97.14 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze hexa-1,5-dien-3-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexa-1,5-dien-3-olate?
The IUPAC name of hexa-1,5-dien-3-olate (CID 101095679) is hexa-1,5-dien-3-olate.
What is the SMILES notation for hexa-1,5-dien-3-olate?
The canonical SMILES for hexa-1,5-dien-3-olate is C=CCC([O-])C=C.
What is the InChIKey of hexa-1,5-dien-3-olate?
The InChIKey is WDOYVYLQROTWRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9O/c1-3-5-6(7)4-2/h3-4,6H,1-2,5H2/q-1.
What are the key properties of hexa-1,5-dien-3-olate?
hexa-1,5-dien-3-olate has a molecular weight of 97.14 g/mol, XLogP of 0.48, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hexa-1,5-dien-3-olate is sourced from PubChem (CID 101095679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).